C20H24ClN5S — CID 16556286
3-[(2-chloro-7,8-dimethylquinolin-3-yl)methylsulfanyl]-5-cyclohexyl-1,2,4-triazol-4-amine (PubChem CID 16556286) has the molecular formula C20H24ClN5S and a molecular weight of 401.97 g/mol. Its IUPAC name is 3-[(2-chloro-7,8-dimethylquinolin-3-yl)methylsulfanyl]-5-cyclohexyl-1,2,4-triazol-4-amine.
| Compound Name | 3-[(2-chloro-7,8-dimethylquinolin-3-yl)methylsulfanyl]-5-cyclohexyl-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 16556286 |
| Molecular Formula | C20H24ClN5S |
| Molecular Weight | 401.97 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 3-[(2-chloro-7,8-dimethylquinolin-3-yl)methylsulfanyl]-5-cyclohexyl-1,2,4-triazol-4-amine |
| SMILES | Cc1ccc2cc(CSc3nnc(C4CCCCC4)n3N)c(Cl)nc2c1C |
| InChI | InChI=1S/C20H24ClN5S/c1-12-8-9-15-10-16(18(21)23-17(15)13(12)2)11-27-20-25-24-19(26(20)22)14-6-4-3-5-7-14/h8-10,14H,3-7,11,22H2,1-2H3 |
| InChIKey | LISYTTWOVHSHNZ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.97 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|