C17H22N2O2S — CID 135095113
N-(1,1-dioxothian-4-yl)-4,7,8-trimethylquinolin-2-amine (PubChem CID 135095113) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-4,7,8-trimethylquinolin-2-amine.
| Compound Name | N-(1,1-dioxothian-4-yl)-4,7,8-trimethylquinolin-2-amine |
|---|---|
| PubChem CID | 135095113 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-4,7,8-trimethylquinolin-2-amine |
| SMILES | Cc1ccc2c(C)cc(NC3CCS(=O)(=O)CC3)nc2c1C |
| InChI | InChI=1S/C17H22N2O2S/c1-11-4-5-15-12(2)10-16(19-17(15)13(11)3)18-14-6-8-22(20,21)9-7-14/h4-5,10,14H,6-9H2,1-3H3,(H,18,19) |
| InChIKey | GXIYBKDHSXXDCP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |