C21H23ClN3O+ — CID 7177644
4-(4-chlorophenyl)-1-[(5-phenyl-1H-pyrazol-4-yl)methyl]piperidin-1-ium-4-ol (PubChem CID 7177644) has the molecular formula C21H23ClN3O+ and a molecular weight of 368.89 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-[(5-phenyl-1H-pyrazol-4-yl)methyl]piperidin-1-ium-4-ol.
| Compound Name | 4-(4-chlorophenyl)-1-[(5-phenyl-1H-pyrazol-4-yl)methyl]piperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 7177644 |
| Molecular Formula | C21H23ClN3O+ |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 4-(4-chlorophenyl)-1-[(5-phenyl-1H-pyrazol-4-yl)methyl]piperidin-1-ium-4-ol |
| SMILES | OC1(c2ccc(Cl)cc2)CC[NH+](Cc2cn[nH]c2-c2ccccc2)CC1 |
| InChI | InChI=1S/C21H22ClN3O/c22-19-8-6-18(7-9-19)21(26)10-12-25(13-11-21)15-17-14-23-24-20(17)16-4-2-1-3-5-16/h1-9,14,26H,10-13,15H2,(H,23,24)/p+1 |
| InChIKey | ZXQHRBFBUMIXGG-UHFFFAOYSA-O |
| XLogP | 2.80 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |