C27H27ClN4 — CID 3950108
1-benzhydryl-4-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]piperazine (PubChem CID 3950108) has the molecular formula C27H27ClN4 and a molecular weight of 442.99 g/mol. Its IUPAC name is 1-benzhydryl-4-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]piperazine.
| Compound Name | 1-benzhydryl-4-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]piperazine |
|---|---|
| PubChem CID | 3950108 |
| Molecular Formula | C27H27ClN4 |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 1-benzhydryl-4-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]piperazine |
| SMILES | Clc1ccc(-c2[nH]ncc2CN2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H27ClN4/c28-25-13-11-21(12-14-25)26-24(19-29-30-26)20-31-15-17-32(18-16-31)27(22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-14,19,27H,15-18,20H2,(H,29,30) |
| InChIKey | KXIFWDRKQNVWIK-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |