C16H21Cl2N3O — CID 56827879
4-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methylamino]cyclohexan-1-ol;hydrochloride (PubChem CID 56827879) has the molecular formula C16H21Cl2N3O and a molecular weight of 342.27 g/mol. Its IUPAC name is 4-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methylamino]cyclohexan-1-ol;hydrochloride.
| Compound Name | 4-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methylamino]cyclohexan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 56827879 |
| Molecular Formula | C16H21Cl2N3O |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 4-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methylamino]cyclohexan-1-ol;hydrochloride |
| SMILES | Cl.OC1CCC(NCc2cn[nH]c2-c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H20ClN3O.ClH/c17-13-3-1-11(2-4-13)16-12(10-19-20-16)9-18-14-5-7-15(21)8-6-14;/h1-4,10,14-15,18,21H,5-9H2,(H,19,20);1H |
| InChIKey | IPKQMSAZUUCSQR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |