C16H17Cl2N3 — CID 4693870
N-[[5-(2,4-dichlorophenyl)-1H-pyrazol-4-yl]methyl]-N-prop-2-enylprop-2-en-1-amine (PubChem CID 4693870) has the molecular formula C16H17Cl2N3 and a molecular weight of 322.24 g/mol. Its IUPAC name is N-[[5-(2,4-dichlorophenyl)-1H-pyrazol-4-yl]methyl]-N-prop-2-enylprop-2-en-1-amine.
| Compound Name | N-[[5-(2,4-dichlorophenyl)-1H-pyrazol-4-yl]methyl]-N-prop-2-enylprop-2-en-1-amine |
|---|---|
| PubChem CID | 4693870 |
| Molecular Formula | C16H17Cl2N3 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | N-[[5-(2,4-dichlorophenyl)-1H-pyrazol-4-yl]methyl]-N-prop-2-enylprop-2-en-1-amine |
| SMILES | C=CCN(CC=C)Cc1cn[nH]c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H17Cl2N3/c1-3-7-21(8-4-2)11-12-10-19-20-16(12)14-6-5-13(17)9-15(14)18/h3-6,9-10H,1-2,7-8,11H2,(H,19,20) |
| InChIKey | QBSKLCLIOFNYJM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|