C18H21FN3O3+ — CID 9340195
1-[(5-fluoro-2-methoxyphenyl)methyl]-4-(2-nitrophenyl)piperazin-1-ium (PubChem CID 9340195) has the molecular formula C18H21FN3O3+ and a molecular weight of 346.38 g/mol. Its IUPAC name is 1-[(5-fluoro-2-methoxyphenyl)methyl]-4-(2-nitrophenyl)piperazin-1-ium.
| Compound Name | 1-[(5-fluoro-2-methoxyphenyl)methyl]-4-(2-nitrophenyl)piperazin-1-ium |
|---|---|
| PubChem CID | 9340195 |
| Molecular Formula | C18H21FN3O3+ |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 1-[(5-fluoro-2-methoxyphenyl)methyl]-4-(2-nitrophenyl)piperazin-1-ium |
| SMILES | COc1ccc(F)cc1C[NH+]1CCN(c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H20FN3O3/c1-25-18-7-6-15(19)12-14(18)13-20-8-10-21(11-9-20)16-4-2-3-5-17(16)22(23)24/h2-7,12H,8-11,13H2,1H3/p+1 |
| InChIKey | WLASZHWZHRFDRY-UHFFFAOYSA-O |
| XLogP | 1.65 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|