C17H21FN4O3+2 — CID 9340225
1-[(5-fluoro-2-methoxyphenyl)methyl]-4-(3-nitropyridin-1-ium-2-yl)piperazin-1-ium (PubChem CID 9340225) has the molecular formula C17H21FN4O3+2 and a molecular weight of 348.38 g/mol. Its IUPAC name is 1-[(5-fluoro-2-methoxyphenyl)methyl]-4-(3-nitropyridin-1-ium-2-yl)piperazin-1-ium.
| Compound Name | 1-[(5-fluoro-2-methoxyphenyl)methyl]-4-(3-nitropyridin-1-ium-2-yl)piperazin-1-ium |
|---|---|
| PubChem CID | 9340225 |
| Molecular Formula | C17H21FN4O3+2 |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-[(5-fluoro-2-methoxyphenyl)methyl]-4-(3-nitropyridin-1-ium-2-yl)piperazin-1-ium |
| SMILES | COc1ccc(F)cc1C[NH+]1CCN(c2[nH+]cccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H19FN4O3/c1-25-16-5-4-14(18)11-13(16)12-20-7-9-21(10-8-20)17-15(22(23)24)3-2-6-19-17/h2-6,11H,7-10,12H2,1H3/p+2 |
| InChIKey | FZNYXNVNFJLQMY-UHFFFAOYSA-P |
| XLogP | 0.46 |
| TPSA | 74.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|