C21H27FN4O4+2 — CID 9436379
(2R)-2-[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]-N-(2-nitrophenyl)propanamide (PubChem CID 9436379) has the molecular formula C21H27FN4O4+2 and a molecular weight of 418.47 g/mol. Its IUPAC name is (2R)-2-[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]-N-(2-nitrophenyl)propanamide.
| Compound Name | (2R)-2-[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]-N-(2-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 9436379 |
| Molecular Formula | C21H27FN4O4+2 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | (2R)-2-[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]-N-(2-nitrophenyl)propanamide |
| SMILES | COc1ccc(F)cc1C[NH+]1CC[NH+]([C@H](C)C(=O)Nc2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H25FN4O4/c1-15(21(27)23-18-5-3-4-6-19(18)26(28)29)25-11-9-24(10-12-25)14-16-13-17(22)7-8-20(16)30-2/h3-8,13,15H,9-12,14H2,1-2H3,(H,23,27)/p+2/t15-/m1/s1 |
| InChIKey | JQLSQLFJWPJBMB-OAHLLOKOSA-P |
| XLogP | 0.05 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|