C17H22N5O4+ — CID 7446430
2-[4-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperazin-4-ium-1-yl]pyrimidine (PubChem CID 7446430) has the molecular formula C17H22N5O4+ and a molecular weight of 360.39 g/mol. Its IUPAC name is 2-[4-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperazin-4-ium-1-yl]pyrimidine.
| Compound Name | 2-[4-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperazin-4-ium-1-yl]pyrimidine |
|---|---|
| PubChem CID | 7446430 |
| Molecular Formula | C17H22N5O4+ |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 2-[4-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperazin-4-ium-1-yl]pyrimidine |
| SMILES | COc1cc(C[NH+]2CCN(c3ncccn3)CC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C17H21N5O4/c1-25-15-10-13(14(22(23)24)11-16(15)26-2)12-20-6-8-21(9-7-20)17-18-4-3-5-19-17/h3-5,10-11H,6-9,12H2,1-2H3/p+1 |
| InChIKey | QJIZRBLBVWZJBQ-UHFFFAOYSA-O |
| XLogP | 0.31 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|