C16H20BrN4O2+ — CID 7446386
2-bromo-6-methoxy-4-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]phenol (PubChem CID 7446386) has the molecular formula C16H20BrN4O2+ and a molecular weight of 380.27 g/mol. Its IUPAC name is 2-bromo-6-methoxy-4-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]phenol.
| Compound Name | 2-bromo-6-methoxy-4-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 7446386 |
| Molecular Formula | C16H20BrN4O2+ |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 2-bromo-6-methoxy-4-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]phenol |
| SMILES | COc1cc(C[NH+]2CCN(c3ncccn3)CC2)cc(Br)c1O |
| InChI | InChI=1S/C16H19BrN4O2/c1-23-14-10-12(9-13(17)15(14)22)11-20-5-7-21(8-6-20)16-18-3-2-4-19-16/h2-4,9-10,22H,5-8,11H2,1H3/p+1 |
| InChIKey | WSERILGMUPGKPF-UHFFFAOYSA-O |
| XLogP | 0.86 |
| TPSA | 62.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |