C16H26NO3+ — CID 6940243
4-(azocan-1-ium-1-ylmethyl)-2,6-dimethoxyphenol (PubChem CID 6940243) has the molecular formula C16H26NO3+ and a molecular weight of 280.39 g/mol. Its IUPAC name is 4-(azocan-1-ium-1-ylmethyl)-2,6-dimethoxyphenol.
| Compound Name | 4-(azocan-1-ium-1-ylmethyl)-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 6940243 |
| Molecular Formula | C16H26NO3+ |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 4-(azocan-1-ium-1-ylmethyl)-2,6-dimethoxyphenol |
| SMILES | COc1cc(C[NH+]2CCCCCCC2)cc(OC)c1O |
| InChI | InChI=1S/C16H25NO3/c1-19-14-10-13(11-15(20-2)16(14)18)12-17-8-6-4-3-5-7-9-17/h10-11,18H,3-9,12H2,1-2H3/p+1 |
| InChIKey | GJDBORDVUDWGCC-UHFFFAOYSA-O |
| XLogP | 1.76 |
| TPSA | 43.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |