C12H19NO4Si — CID 14108631
(4,5-dimethoxy-2-nitrophenyl)methyl-trimethylsilane (PubChem CID 14108631) has the molecular formula C12H19NO4Si and a molecular weight of 269.37 g/mol. Its IUPAC name is (4,5-dimethoxy-2-nitrophenyl)methyl-trimethylsilane.
| Compound Name | (4,5-dimethoxy-2-nitrophenyl)methyl-trimethylsilane |
|---|---|
| PubChem CID | 14108631 |
| Molecular Formula | C12H19NO4Si |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (4,5-dimethoxy-2-nitrophenyl)methyl-trimethylsilane |
| SMILES | COc1cc(C[Si](C)(C)C)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C12H19NO4Si/c1-16-11-6-9(8-18(3,4)5)10(13(14)15)7-12(11)17-2/h6-7H,8H2,1-5H3 |
| InChIKey | ZCPAYNXQWAYNMA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|