C11H15NO7S — CID 18789880
2-(4,5-dimethoxy-2-nitrophenyl)ethyl methanesulfonate (PubChem CID 18789880) has the molecular formula C11H15NO7S and a molecular weight of 305.31 g/mol. Its IUPAC name is 2-(4,5-dimethoxy-2-nitrophenyl)ethyl methanesulfonate.
| Compound Name | 2-(4,5-dimethoxy-2-nitrophenyl)ethyl methanesulfonate |
|---|---|
| PubChem CID | 18789880 |
| Molecular Formula | C11H15NO7S |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 2-(4,5-dimethoxy-2-nitrophenyl)ethyl methanesulfonate |
| SMILES | COc1cc(CCOS(C)(=O)=O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C11H15NO7S/c1-17-10-6-8(4-5-19-20(3,15)16)9(12(13)14)7-11(10)18-2/h6-7H,4-5H2,1-3H3 |
| InChIKey | WHUHNDPDJOELGL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|