C14H19NO6S — CID 163504396
2-(4,5-dimethoxy-2-nitrophenyl)ethyl 4-sulfanylbutanoate (PubChem CID 163504396) has the molecular formula C14H19NO6S and a molecular weight of 329.37 g/mol. Its IUPAC name is 2-(4,5-dimethoxy-2-nitrophenyl)ethyl 4-sulfanylbutanoate.
| Compound Name | 2-(4,5-dimethoxy-2-nitrophenyl)ethyl 4-sulfanylbutanoate |
|---|---|
| PubChem CID | 163504396 |
| Molecular Formula | C14H19NO6S |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-(4,5-dimethoxy-2-nitrophenyl)ethyl 4-sulfanylbutanoate |
| SMILES | COc1cc(CCOC(=O)CCCS)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C14H19NO6S/c1-19-12-8-10(5-6-21-14(16)4-3-7-22)11(15(17)18)9-13(12)20-2/h8-9,22H,3-7H2,1-2H3 |
| InChIKey | HQDZTBQSZGLHDK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|