C10H10ClNO6 — CID 66825141
chloro 2-(4,5-dimethoxy-2-nitrophenyl)acetate (PubChem CID 66825141) has the molecular formula C10H10ClNO6 and a molecular weight of 275.64 g/mol. Its IUPAC name is chloro 2-(4,5-dimethoxy-2-nitrophenyl)acetate.
| Compound Name | chloro 2-(4,5-dimethoxy-2-nitrophenyl)acetate |
|---|---|
| PubChem CID | 66825141 |
| Molecular Formula | C10H10ClNO6 |
| Molecular Weight | 275.64 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | chloro 2-(4,5-dimethoxy-2-nitrophenyl)acetate |
| SMILES | COc1cc(CC(=O)OCl)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C10H10ClNO6/c1-16-8-3-6(4-10(13)18-11)7(12(14)15)5-9(8)17-2/h3,5H,4H2,1-2H3 |
| InChIKey | HVCKCZSDJYBXKD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.64 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|