C14H19NO6 — CID 59707797
3-[(4,5-dimethoxy-2-nitrophenyl)methoxy]-3-methylbutan-2-one (PubChem CID 59707797) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is 3-[(4,5-dimethoxy-2-nitrophenyl)methoxy]-3-methylbutan-2-one.
| Compound Name | 3-[(4,5-dimethoxy-2-nitrophenyl)methoxy]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 59707797 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 3-[(4,5-dimethoxy-2-nitrophenyl)methoxy]-3-methylbutan-2-one |
| SMILES | COc1cc(COC(C)(C)C(C)=O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C14H19NO6/c1-9(16)14(2,3)21-8-10-6-12(19-4)13(20-5)7-11(10)15(17)18/h6-7H,8H2,1-5H3 |
| InChIKey | TXZGCIRQLCIGNM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|