C18H27NO9 — CID 144955666
ethyl 3-[(4,5-dimethoxy-2-nitrophenyl)methoxymethoxy]-2-methoxy-3-methylbutanoate (PubChem CID 144955666) has the molecular formula C18H27NO9 and a molecular weight of 401.41 g/mol. Its IUPAC name is ethyl 3-[(4,5-dimethoxy-2-nitrophenyl)methoxymethoxy]-2-methoxy-3-methylbutanoate.
| Compound Name | ethyl 3-[(4,5-dimethoxy-2-nitrophenyl)methoxymethoxy]-2-methoxy-3-methylbutanoate |
|---|---|
| PubChem CID | 144955666 |
| Molecular Formula | C18H27NO9 |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | ethyl 3-[(4,5-dimethoxy-2-nitrophenyl)methoxymethoxy]-2-methoxy-3-methylbutanoate |
| SMILES | CCOC(=O)C(OC)C(C)(C)OCOCc1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H27NO9/c1-7-27-17(20)16(25-6)18(2,3)28-11-26-10-12-8-14(23-4)15(24-5)9-13(12)19(21)22/h8-9,16H,7,10-11H2,1-6H3 |
| InChIKey | CJZGKKGMXITSKD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 115.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|