C24H26N2O16 — CID 126681123
ethyl 2-[[4,5-bis(hydroxymethyl)-2-nitrophenyl]methoxycarbonyloxy]-2-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonyloxy]acetate (PubChem CID 126681123) has the molecular formula C24H26N2O16 and a molecular weight of 598.47 g/mol. Its IUPAC name is ethyl 2-[[4,5-bis(hydroxymethyl)-2-nitrophenyl]methoxycarbonyloxy]-2-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonyloxy]acetate.
| Compound Name | ethyl 2-[[4,5-bis(hydroxymethyl)-2-nitrophenyl]methoxycarbonyloxy]-2-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonyloxy]acetate |
|---|---|
| PubChem CID | 126681123 |
| Molecular Formula | C24H26N2O16 |
| Molecular Weight | 598.47 g/mol |
| Exact Mass | 598.13 |
| IUPAC Name | ethyl 2-[[4,5-bis(hydroxymethyl)-2-nitrophenyl]methoxycarbonyloxy]-2-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonyloxy]acetate |
| SMILES | CCOC(=O)C(OC(=O)OCc1cc(CO)c(CO)cc1[N+](=O)[O-])OC(=O)OCc1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H26N2O16/c1-4-38-21(29)22(41-23(30)39-11-15-5-13(9-27)14(10-28)6-17(15)25(32)33)42-24(31)40-12-16-7-19(36-2)20(37-3)8-18(16)26(34)35/h5-8,22,27-28H,4,9-12H2,1-3H3 |
| InChIKey | HALQUKLQRQMGOO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 242.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|