C13H18N2O7 — CID 135564323
methyl (2S)-2-amino-3-[(4,5-dimethoxy-2-nitrophenyl)methoxy]propanoate (PubChem CID 135564323) has the molecular formula C13H18N2O7 and a molecular weight of 314.29 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-[(4,5-dimethoxy-2-nitrophenyl)methoxy]propanoate.
| Compound Name | methyl (2S)-2-amino-3-[(4,5-dimethoxy-2-nitrophenyl)methoxy]propanoate |
|---|---|
| PubChem CID | 135564323 |
| Molecular Formula | C13H18N2O7 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | methyl (2S)-2-amino-3-[(4,5-dimethoxy-2-nitrophenyl)methoxy]propanoate |
| SMILES | COC(=O)[C@@H](N)COCc1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18N2O7/c1-19-11-4-8(6-22-7-9(14)13(16)21-3)10(15(17)18)5-12(11)20-2/h4-5,9H,6-7,14H2,1-3H3/t9-/m0/s1 |
| InChIKey | WKLHEIXHFRQMSP-VIFPVBQESA-N |
| XLogP | 0.63 |
| TPSA | 123.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|