C25H40N4O12S — CID 101253111
(2R)-2-amino-3-[2-[3-[2-[2-[3-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonylamino]propoxy]ethoxy]ethoxy]propylamino]-2-oxoethyl]sulfanylpropanoic acid (PubChem CID 101253111) has the molecular formula C25H40N4O12S and a molecular weight of 620.68 g/mol. Its IUPAC name is (2R)-2-amino-3-[2-[3-[2-[2-[3-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonylamino]propoxy]ethoxy]ethoxy]propylamino]-2-oxoethyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-amino-3-[2-[3-[2-[2-[3-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonylamino]propoxy]ethoxy]ethoxy]propylamino]-2-oxoethyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 101253111 |
| Molecular Formula | C25H40N4O12S |
| Molecular Weight | 620.68 g/mol |
| Exact Mass | 620.24 |
| IUPAC Name | (2R)-2-amino-3-[2-[3-[2-[2-[3-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonylamino]propoxy]ethoxy]ethoxy]propylamino]-2-oxoethyl]sulfanylpropanoic acid |
| SMILES | COc1cc(COC(=O)NCCCOCCOCCOCCCNC(=O)CSC[C@H](N)C(=O)O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C25H40N4O12S/c1-36-21-13-18(20(29(34)35)14-22(21)37-2)15-41-25(33)28-6-4-8-39-10-12-40-11-9-38-7-3-5-27-23(30)17-42-16-19(26)24(31)32/h13-14,19H,3-12,15-17,26H2,1-2H3,(H,27,30)(H,28,33)(H,31,32)/t19-/m0/s1 |
| InChIKey | DXESMJGPLRHRDJ-IBGZPJMESA-N |
| XLogP | 0.93 |
| TPSA | 220.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.68 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|