C17H23IN2O7S — CID 90077434
S-(2-iodoethyl) 3-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonylamino]-2,2-dimethylpropanethioate (PubChem CID 90077434) has the molecular formula C17H23IN2O7S and a molecular weight of 526.35 g/mol. Its IUPAC name is S-(2-iodoethyl) 3-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonylamino]-2,2-dimethylpropanethioate.
| Compound Name | S-(2-iodoethyl) 3-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonylamino]-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 90077434 |
| Molecular Formula | C17H23IN2O7S |
| Molecular Weight | 526.35 g/mol |
| Exact Mass | 526.03 |
| IUPAC Name | S-(2-iodoethyl) 3-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonylamino]-2,2-dimethylpropanethioate |
| SMILES | COc1cc(COC(=O)NCC(C)(C)C(=O)SCCI)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C17H23IN2O7S/c1-17(2,15(21)28-6-5-18)10-19-16(22)27-9-11-7-13(25-3)14(26-4)8-12(11)20(23)24/h7-8H,5-6,9-10H2,1-4H3,(H,19,22) |
| InChIKey | XRFPIJCXAHXKDP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|