C20H32N2O7S — CID 144579876
ethane;S-propyl 3-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonylamino]-2,2-dimethylpropanethioate (PubChem CID 144579876) has the molecular formula C20H32N2O7S and a molecular weight of 444.55 g/mol. Its IUPAC name is ethane;S-propyl 3-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonylamino]-2,2-dimethylpropanethioate.
| Compound Name | ethane;S-propyl 3-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonylamino]-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 144579876 |
| Molecular Formula | C20H32N2O7S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | ethane;S-propyl 3-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonylamino]-2,2-dimethylpropanethioate |
| SMILES | CC.CCCSC(=O)C(C)(C)CNC(=O)OCc1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H26N2O7S.C2H6/c1-6-7-28-16(21)18(2,3)11-19-17(22)27-10-12-8-14(25-4)15(26-5)9-13(12)20(23)24;1-2/h8-9H,6-7,10-11H2,1-5H3,(H,19,22);1-2H3 |
| InChIKey | HNCKMEKEPKLHRY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|