C21H32N2O7S — CID 118333711
S-(3,3-dimethylbutyl) 3-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonylamino]-2,2-dimethylpropanethioate (PubChem CID 118333711) has the molecular formula C21H32N2O7S and a molecular weight of 456.56 g/mol. Its IUPAC name is S-(3,3-dimethylbutyl) 3-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonylamino]-2,2-dimethylpropanethioate.
| Compound Name | S-(3,3-dimethylbutyl) 3-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonylamino]-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 118333711 |
| Molecular Formula | C21H32N2O7S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | S-(3,3-dimethylbutyl) 3-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonylamino]-2,2-dimethylpropanethioate |
| SMILES | COc1cc(COC(=O)NCC(C)(C)C(=O)SCCC(C)(C)C)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C21H32N2O7S/c1-20(2,3)8-9-31-18(24)21(4,5)13-22-19(25)30-12-14-10-16(28-6)17(29-7)11-15(14)23(26)27/h10-11H,8-9,12-13H2,1-7H3,(H,22,25) |
| InChIKey | GOHORGRCAQGVRR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|