C19H28NO12PS — CID 118333755
S-(2-dimethoxyphosphoryloxyethyl) 3-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonyloxy]-2,2-dimethylpropanethioate (PubChem CID 118333755) has the molecular formula C19H28NO12PS and a molecular weight of 525.47 g/mol. Its IUPAC name is S-(2-dimethoxyphosphoryloxyethyl) 3-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonyloxy]-2,2-dimethylpropanethioate.
| Compound Name | S-(2-dimethoxyphosphoryloxyethyl) 3-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonyloxy]-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 118333755 |
| Molecular Formula | C19H28NO12PS |
| Molecular Weight | 525.47 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | S-(2-dimethoxyphosphoryloxyethyl) 3-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonyloxy]-2,2-dimethylpropanethioate |
| SMILES | COc1cc(COC(=O)OCC(C)(C)C(=O)SCCOP(=O)(OC)OC)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H28NO12PS/c1-19(2,17(21)34-8-7-32-33(25,28-5)29-6)12-31-18(22)30-11-13-9-15(26-3)16(27-4)10-14(13)20(23)24/h9-10H,7-8,11-12H2,1-6H3 |
| InChIKey | ZLOLHNOTFXCYIZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 158.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|