C13H20N2O6 — CID 170600738
(4,5-dimethoxy-2-nitrophenyl)methyl N-methylcarbamate;ethane (PubChem CID 170600738) has the molecular formula C13H20N2O6 and a molecular weight of 300.31 g/mol. Its IUPAC name is (4,5-dimethoxy-2-nitrophenyl)methyl N-methylcarbamate;ethane.
| Compound Name | (4,5-dimethoxy-2-nitrophenyl)methyl N-methylcarbamate;ethane |
|---|---|
| PubChem CID | 170600738 |
| Molecular Formula | C13H20N2O6 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | (4,5-dimethoxy-2-nitrophenyl)methyl N-methylcarbamate;ethane |
| SMILES | CC.CNC(=O)OCc1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14N2O6.C2H6/c1-12-11(14)19-6-7-4-9(17-2)10(18-3)5-8(7)13(15)16;1-2/h4-5H,6H2,1-3H3,(H,12,14);1-2H3 |
| InChIKey | KCZKSKJNLVHXHS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|