About ethane;(5-ethyl-2-nitrophenyl)methyl N-methylcarbamate
ethane;(5-ethyl-2-nitrophenyl)methyl N-methylcarbamate (PubChem CID 142127917) has the molecular formula C13H20N2O4
and a molecular weight of 268.31 g/mol. Its IUPAC name is ethane;(5-ethyl-2-nitrophenyl)methyl N-methylcarbamate.
Molecular Properties
| Compound Name | ethane;(5-ethyl-2-nitrophenyl)methyl N-methylcarbamate |
| PubChem CID | 142127917 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | ethane;(5-ethyl-2-nitrophenyl)methyl N-methylcarbamate |
| SMILES | CC.CCc1ccc([N+](=O)[O-])c(COC(=O)NC)c1 |
| InChI | InChI=1S/C11H14N2O4.C2H6/c1-3-8-4-5-10(13(15)16)9(6-8)7-17-11(14)12-2;1-2/h4-6H,3,7H2,1-2H3,(H,12,14);1-2H3 |
| InChIKey | KPBUTJIGNRULSA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;(5-ethyl-2-nitrophenyl)methyl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(5-ethyl-2-nitrophenyl)methyl N-methylcarbamate?
The IUPAC name of ethane;(5-ethyl-2-nitrophenyl)methyl N-methylcarbamate (CID 142127917) is ethane;(5-ethyl-2-nitrophenyl)methyl N-methylcarbamate.
What is the SMILES notation for ethane;(5-ethyl-2-nitrophenyl)methyl N-methylcarbamate?
The canonical SMILES for ethane;(5-ethyl-2-nitrophenyl)methyl N-methylcarbamate is CC.CCc1ccc([N+](=O)[O-])c(COC(=O)NC)c1.
What is the InChIKey of ethane;(5-ethyl-2-nitrophenyl)methyl N-methylcarbamate?
The InChIKey is KPBUTJIGNRULSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O4.C2H6/c1-3-8-4-5-10(13(15)16)9(6-8)7-17-11(14)12-2;1-2/h4-6H,3,7H2,1-2H3,(H,12,14);1-2H3.
What are the key properties of ethane;(5-ethyl-2-nitrophenyl)methyl N-methylcarbamate?
ethane;(5-ethyl-2-nitrophenyl)methyl N-methylcarbamate has a molecular weight of 268.31 g/mol, XLogP of 3.04, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(5-ethyl-2-nitrophenyl)methyl N-methylcarbamate is sourced from PubChem (CID 142127917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).