C10H11N3O6 — CID 66222638
methyl 2-amino-3-(2,4-dinitrophenyl)propanoate (PubChem CID 66222638) has the molecular formula C10H11N3O6 and a molecular weight of 269.21 g/mol. Its IUPAC name is methyl 2-amino-3-(2,4-dinitrophenyl)propanoate.
| Compound Name | methyl 2-amino-3-(2,4-dinitrophenyl)propanoate |
|---|---|
| PubChem CID | 66222638 |
| Molecular Formula | C10H11N3O6 |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | methyl 2-amino-3-(2,4-dinitrophenyl)propanoate |
| SMILES | COC(=O)C(N)Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11N3O6/c1-19-10(14)8(11)4-6-2-3-7(12(15)16)5-9(6)13(17)18/h2-3,5,8H,4,11H2,1H3 |
| InChIKey | ROUPILGDIOVKBD-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 138.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|