C14H20N2O6 — CID 3985302
ethyl 3-[(4,5-dimethoxy-2-nitrophenyl)methylamino]propanoate (PubChem CID 3985302) has the molecular formula C14H20N2O6 and a molecular weight of 312.32 g/mol. Its IUPAC name is ethyl 3-[(4,5-dimethoxy-2-nitrophenyl)methylamino]propanoate.
| Compound Name | ethyl 3-[(4,5-dimethoxy-2-nitrophenyl)methylamino]propanoate |
|---|---|
| PubChem CID | 3985302 |
| Molecular Formula | C14H20N2O6 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | ethyl 3-[(4,5-dimethoxy-2-nitrophenyl)methylamino]propanoate |
| SMILES | CCOC(=O)CCNCc1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H20N2O6/c1-4-22-14(17)5-6-15-9-10-7-12(20-2)13(21-3)8-11(10)16(18)19/h7-8,15H,4-6,9H2,1-3H3 |
| InChIKey | KWZAEECLDGADQH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|