C17H20FN7S+2 — CID 9280823
1-(3-fluorophenyl)-4-[(4-pyridin-1-ium-4-ylpiperazin-1-ium-1-yl)methyl]tetrazole-5-thione (PubChem CID 9280823) has the molecular formula C17H20FN7S+2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-4-[(4-pyridin-1-ium-4-ylpiperazin-1-ium-1-yl)methyl]tetrazole-5-thione.
| Compound Name | 1-(3-fluorophenyl)-4-[(4-pyridin-1-ium-4-ylpiperazin-1-ium-1-yl)methyl]tetrazole-5-thione |
|---|---|
| PubChem CID | 9280823 |
| Molecular Formula | C17H20FN7S+2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 1-(3-fluorophenyl)-4-[(4-pyridin-1-ium-4-ylpiperazin-1-ium-1-yl)methyl]tetrazole-5-thione |
| SMILES | Fc1cccc(-n2nnn(C[NH+]3CCN(c4cc[nH+]cc4)CC3)c2=S)c1 |
| InChI | InChI=1S/C17H18FN7S/c18-14-2-1-3-16(12-14)25-17(26)24(20-21-25)13-22-8-10-23(11-9-22)15-4-6-19-7-5-15/h1-7,12H,8-11,13H2/p+2 |
| InChIKey | WQIDGQNTEYEGHH-UHFFFAOYSA-P |
| XLogP | 0.11 |
| TPSA | 57.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|