C17H19FN6S2 — CID 9332253
1-(3-fluorophenyl)-4-[[4-(thiophen-3-ylmethyl)piperazin-1-yl]methyl]tetrazole-5-thione (PubChem CID 9332253) has the molecular formula C17H19FN6S2 and a molecular weight of 390.51 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-4-[[4-(thiophen-3-ylmethyl)piperazin-1-yl]methyl]tetrazole-5-thione.
| Compound Name | 1-(3-fluorophenyl)-4-[[4-(thiophen-3-ylmethyl)piperazin-1-yl]methyl]tetrazole-5-thione |
|---|---|
| PubChem CID | 9332253 |
| Molecular Formula | C17H19FN6S2 |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 1-(3-fluorophenyl)-4-[[4-(thiophen-3-ylmethyl)piperazin-1-yl]methyl]tetrazole-5-thione |
| SMILES | Fc1cccc(-n2nnn(CN3CCN(Cc4ccsc4)CC3)c2=S)c1 |
| InChI | InChI=1S/C17H19FN6S2/c18-15-2-1-3-16(10-15)24-17(25)23(19-20-24)13-22-7-5-21(6-8-22)11-14-4-9-26-12-14/h1-4,9-10,12H,5-8,11,13H2 |
| InChIKey | VSGCHMZRYDWHQP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 42.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|