C20H23N5S2 — CID 17465259
5-[(E)-2-phenylethenyl]-2-[[4-(thiophen-3-ylmethyl)piperazin-1-yl]methyl]-1H-1,2,4-triazole-3-thione (PubChem CID 17465259) has the molecular formula C20H23N5S2 and a molecular weight of 397.57 g/mol. Its IUPAC name is 5-[(E)-2-phenylethenyl]-2-[[4-(thiophen-3-ylmethyl)piperazin-1-yl]methyl]-1H-1,2,4-triazole-3-thione.
| Compound Name | 5-[(E)-2-phenylethenyl]-2-[[4-(thiophen-3-ylmethyl)piperazin-1-yl]methyl]-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 17465259 |
| Molecular Formula | C20H23N5S2 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 5-[(E)-2-phenylethenyl]-2-[[4-(thiophen-3-ylmethyl)piperazin-1-yl]methyl]-1H-1,2,4-triazole-3-thione |
| SMILES | S=c1nc(/C=C/c2ccccc2)[nH]n1CN1CCN(Cc2ccsc2)CC1 |
| InChI | InChI=1S/C20H23N5S2/c26-20-21-19(7-6-17-4-2-1-3-5-17)22-25(20)16-24-11-9-23(10-12-24)14-18-8-13-27-15-18/h1-8,13,15H,9-12,14,16H2,(H,21,22,26)/b7-6+ |
| InChIKey | XZXNPBDTUUMZSN-VOTSOKGWSA-N |
| XLogP | 3.95 |
| TPSA | 40.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|