C20H23N5S — CID 11595742
2-[(4-benzylpiperazin-1-yl)methyl]-5-phenyl-1H-1,2,4-triazole-3-thione (PubChem CID 11595742) has the molecular formula C20H23N5S and a molecular weight of 365.51 g/mol. Its IUPAC name is 2-[(4-benzylpiperazin-1-yl)methyl]-5-phenyl-1H-1,2,4-triazole-3-thione.
| Compound Name | 2-[(4-benzylpiperazin-1-yl)methyl]-5-phenyl-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 11595742 |
| Molecular Formula | C20H23N5S |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 2-[(4-benzylpiperazin-1-yl)methyl]-5-phenyl-1H-1,2,4-triazole-3-thione |
| SMILES | S=c1nc(-c2ccccc2)[nH]n1CN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H23N5S/c26-20-21-19(18-9-5-2-6-10-18)22-25(20)16-24-13-11-23(12-14-24)15-17-7-3-1-4-8-17/h1-10H,11-16H2,(H,21,22,26) |
| InChIKey | UQADUNOSRZBPLX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 40.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|