C17H24N4S — CID 7479951
5-(4-ethylphenyl)-2-[[(3R)-3-methylpiperidin-1-yl]methyl]-1H-1,2,4-triazole-3-thione (PubChem CID 7479951) has the molecular formula C17H24N4S and a molecular weight of 316.47 g/mol. Its IUPAC name is 5-(4-ethylphenyl)-2-[[(3R)-3-methylpiperidin-1-yl]methyl]-1H-1,2,4-triazole-3-thione.
| Compound Name | 5-(4-ethylphenyl)-2-[[(3R)-3-methylpiperidin-1-yl]methyl]-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 7479951 |
| Molecular Formula | C17H24N4S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 5-(4-ethylphenyl)-2-[[(3R)-3-methylpiperidin-1-yl]methyl]-1H-1,2,4-triazole-3-thione |
| SMILES | CCc1ccc(-c2nc(=S)n(CN3CCC[C@@H](C)C3)[nH]2)cc1 |
| InChI | InChI=1S/C17H24N4S/c1-3-14-6-8-15(9-7-14)16-18-17(22)21(19-16)12-20-10-4-5-13(2)11-20/h6-9,13H,3-5,10-12H2,1-2H3,(H,18,19,22)/t13-/m1/s1 |
| InChIKey | LFUVZZRWFAZFTR-CYBMUJFWSA-N |
| XLogP | 3.86 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|