C23H27N5OS — CID 9325928
1-[[5-(4-ethylphenyl)-3-sulfanylidene-1H-1,2,4-triazol-2-yl]methyl]-N-phenylpiperidine-4-carboxamide (PubChem CID 9325928) has the molecular formula C23H27N5OS and a molecular weight of 421.57 g/mol. Its IUPAC name is 1-[[5-(4-ethylphenyl)-3-sulfanylidene-1H-1,2,4-triazol-2-yl]methyl]-N-phenylpiperidine-4-carboxamide.
| Compound Name | 1-[[5-(4-ethylphenyl)-3-sulfanylidene-1H-1,2,4-triazol-2-yl]methyl]-N-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 9325928 |
| Molecular Formula | C23H27N5OS |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 1-[[5-(4-ethylphenyl)-3-sulfanylidene-1H-1,2,4-triazol-2-yl]methyl]-N-phenylpiperidine-4-carboxamide |
| SMILES | CCc1ccc(-c2nc(=S)n(CN3CCC(C(=O)Nc4ccccc4)CC3)[nH]2)cc1 |
| InChI | InChI=1S/C23H27N5OS/c1-2-17-8-10-18(11-9-17)21-25-23(30)28(26-21)16-27-14-12-19(13-15-27)22(29)24-20-6-4-3-5-7-20/h3-11,19H,2,12-16H2,1H3,(H,24,29)(H,25,26,30) |
| InChIKey | IKBDVZCPCRUXPY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 65.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|