C18H21N5S2 — CID 9332176
5-phenyl-2-[[4-(thiophen-3-ylmethyl)piperazin-1-yl]methyl]-1H-1,2,4-triazole-3-thione (PubChem CID 9332176) has the molecular formula C18H21N5S2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 5-phenyl-2-[[4-(thiophen-3-ylmethyl)piperazin-1-yl]methyl]-1H-1,2,4-triazole-3-thione.
| Compound Name | 5-phenyl-2-[[4-(thiophen-3-ylmethyl)piperazin-1-yl]methyl]-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9332176 |
| Molecular Formula | C18H21N5S2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 5-phenyl-2-[[4-(thiophen-3-ylmethyl)piperazin-1-yl]methyl]-1H-1,2,4-triazole-3-thione |
| SMILES | S=c1nc(-c2ccccc2)[nH]n1CN1CCN(Cc2ccsc2)CC1 |
| InChI | InChI=1S/C18H21N5S2/c24-18-19-17(16-4-2-1-3-5-16)20-23(18)14-22-9-7-21(8-10-22)12-15-6-11-25-13-15/h1-6,11,13H,7-10,12,14H2,(H,19,20,24) |
| InChIKey | VNIIZFOEFCVKGC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 40.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|