C8H11NS — CID 131087701
1-(thiophen-3-ylmethyl)azetidine (PubChem CID 131087701) has the molecular formula C8H11NS and a molecular weight of 153.25 g/mol. Its IUPAC name is 1-(thiophen-3-ylmethyl)azetidine.
| Compound Name | 1-(thiophen-3-ylmethyl)azetidine |
|---|---|
| PubChem CID | 131087701 |
| Molecular Formula | C8H11NS |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | 1-(thiophen-3-ylmethyl)azetidine |
| SMILES | c1cc(CN2CCC2)cs1 |
| InChI | InChI=1S/C8H11NS/c1-3-9(4-1)6-8-2-5-10-7-8/h2,5,7H,1,3-4,6H2 |
| InChIKey | ZVDNBMYMMPXSFX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |