C22H21N5S — CID 45028812
4-(4-benzylpiperazin-1-yl)-6-phenyl-2-sulfanylidene-1H-pyrimidine-5-carbonitrile (PubChem CID 45028812) has the molecular formula C22H21N5S and a molecular weight of 387.51 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-1-yl)-6-phenyl-2-sulfanylidene-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(4-benzylpiperazin-1-yl)-6-phenyl-2-sulfanylidene-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 45028812 |
| Molecular Formula | C22H21N5S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 4-(4-benzylpiperazin-1-yl)-6-phenyl-2-sulfanylidene-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(N2CCN(Cc3ccccc3)CC2)nc(=S)[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C22H21N5S/c23-15-19-20(18-9-5-2-6-10-18)24-22(28)25-21(19)27-13-11-26(12-14-27)16-17-7-3-1-4-8-17/h1-10H,11-14,16H2,(H,24,25,28) |
| InChIKey | RREGOGDKQPNONJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|