C22H23N7 — CID 110171471
3-(4-benzylpiperazin-1-yl)-6-phenyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 110171471) has the molecular formula C22H23N7 and a molecular weight of 385.48 g/mol. Its IUPAC name is 3-(4-benzylpiperazin-1-yl)-6-phenyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-(4-benzylpiperazin-1-yl)-6-phenyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 110171471 |
| Molecular Formula | C22H23N7 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 3-(4-benzylpiperazin-1-yl)-6-phenyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1nc(-c2ccccc2)nc2[nH]nc(N3CCN(Cc4ccccc4)CC3)c12 |
| InChI | InChI=1S/C22H23N7/c23-19-18-21(25-20(24-19)17-9-5-2-6-10-17)26-27-22(18)29-13-11-28(12-14-29)15-16-7-3-1-4-8-16/h1-10H,11-15H2,(H3,23,24,25,26,27) |
| InChIKey | IBSNRCLIMTVBTO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |