C16H21N5 — CID 80756967
4-(4-benzylpiperazin-1-yl)-5-methylpyrimidin-2-amine (PubChem CID 80756967) has the molecular formula C16H21N5 and a molecular weight of 283.38 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-1-yl)-5-methylpyrimidin-2-amine.
| Compound Name | 4-(4-benzylpiperazin-1-yl)-5-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80756967 |
| Molecular Formula | C16H21N5 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 4-(4-benzylpiperazin-1-yl)-5-methylpyrimidin-2-amine |
| SMILES | Cc1cnc(N)nc1N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C16H21N5/c1-13-11-18-16(17)19-15(13)21-9-7-20(8-10-21)12-14-5-3-2-4-6-14/h2-6,11H,7-10,12H2,1H3,(H2,17,18,19) |
| InChIKey | GIJDOOOPDIQBJV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |