C25H32N8 — CID 133349095
5-methyl-2,4-bis[4-(pyridin-2-ylmethyl)piperazin-1-yl]pyrimidine (PubChem CID 133349095) has the molecular formula C25H32N8 and a molecular weight of 444.59 g/mol. Its IUPAC name is 5-methyl-2,4-bis[4-(pyridin-2-ylmethyl)piperazin-1-yl]pyrimidine.
| Compound Name | 5-methyl-2,4-bis[4-(pyridin-2-ylmethyl)piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 133349095 |
| Molecular Formula | C25H32N8 |
| Molecular Weight | 444.59 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | 5-methyl-2,4-bis[4-(pyridin-2-ylmethyl)piperazin-1-yl]pyrimidine |
| SMILES | Cc1cnc(N2CCN(Cc3ccccn3)CC2)nc1N1CCN(Cc2ccccn2)CC1 |
| InChI | InChI=1S/C25H32N8/c1-21-18-28-25(33-16-12-31(13-17-33)20-23-7-3-5-9-27-23)29-24(21)32-14-10-30(11-15-32)19-22-6-2-4-8-26-22/h2-9,18H,10-17,19-20H2,1H3 |
| InChIKey | GSEWKDMEMYGODV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 64.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.59 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |