C23H27N5OS — CID 55860081
2-[[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methyl]-5-[(E)-2-phenylethenyl]-1H-1,2,4-triazole-3-thione (PubChem CID 55860081) has the molecular formula C23H27N5OS and a molecular weight of 421.57 g/mol. Its IUPAC name is 2-[[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methyl]-5-[(E)-2-phenylethenyl]-1H-1,2,4-triazole-3-thione.
| Compound Name | 2-[[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methyl]-5-[(E)-2-phenylethenyl]-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 55860081 |
| Molecular Formula | C23H27N5OS |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 2-[[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methyl]-5-[(E)-2-phenylethenyl]-1H-1,2,4-triazole-3-thione |
| SMILES | COc1ccc(N2CCCN(Cn3[nH]c(/C=C/c4ccccc4)nc3=S)CC2)cc1 |
| InChI | InChI=1S/C23H27N5OS/c1-29-21-11-9-20(10-12-21)27-15-5-14-26(16-17-27)18-28-23(30)24-22(25-28)13-8-19-6-3-2-4-7-19/h2-4,6-13H,5,14-18H2,1H3,(H,24,25,30)/b13-8+ |
| InChIKey | OCZGSSRSFKATMK-MDWZMJQESA-N |
| XLogP | 4.29 |
| TPSA | 49.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|