C22H24N4OS — CID 18167601
2-[[cyclopropyl-[(4-methoxyphenyl)methyl]amino]methyl]-5-[(E)-2-phenylethenyl]-1H-1,2,4-triazole-3-thione (PubChem CID 18167601) has the molecular formula C22H24N4OS and a molecular weight of 392.53 g/mol. Its IUPAC name is 2-[[cyclopropyl-[(4-methoxyphenyl)methyl]amino]methyl]-5-[(E)-2-phenylethenyl]-1H-1,2,4-triazole-3-thione.
| Compound Name | 2-[[cyclopropyl-[(4-methoxyphenyl)methyl]amino]methyl]-5-[(E)-2-phenylethenyl]-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 18167601 |
| Molecular Formula | C22H24N4OS |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 2-[[cyclopropyl-[(4-methoxyphenyl)methyl]amino]methyl]-5-[(E)-2-phenylethenyl]-1H-1,2,4-triazole-3-thione |
| SMILES | COc1ccc(CN(Cn2[nH]c(/C=C/c3ccccc3)nc2=S)C2CC2)cc1 |
| InChI | InChI=1S/C22H24N4OS/c1-27-20-12-7-18(8-13-20)15-25(19-10-11-19)16-26-22(28)23-21(24-26)14-9-17-5-3-2-4-6-17/h2-9,12-14,19H,10-11,15-16H2,1H3,(H,23,24,28)/b14-9+ |
| InChIKey | FRSBNOGURKXVHI-NTEUORMPSA-N |
| XLogP | 4.74 |
| TPSA | 46.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|