C21H24N4O2S2 — CID 31385921
3-[[cyclopropyl-[(4-methoxyphenyl)methyl]amino]methyl]-5-(2-methoxyanilino)-1,3,4-thiadiazole-2-thione (PubChem CID 31385921) has the molecular formula C21H24N4O2S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 3-[[cyclopropyl-[(4-methoxyphenyl)methyl]amino]methyl]-5-(2-methoxyanilino)-1,3,4-thiadiazole-2-thione.
| Compound Name | 3-[[cyclopropyl-[(4-methoxyphenyl)methyl]amino]methyl]-5-(2-methoxyanilino)-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 31385921 |
| Molecular Formula | C21H24N4O2S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 3-[[cyclopropyl-[(4-methoxyphenyl)methyl]amino]methyl]-5-(2-methoxyanilino)-1,3,4-thiadiazole-2-thione |
| SMILES | COc1ccc(CN(Cn2nc(Nc3ccccc3OC)sc2=S)C2CC2)cc1 |
| InChI | InChI=1S/C21H24N4O2S2/c1-26-17-11-7-15(8-12-17)13-24(16-9-10-16)14-25-21(28)29-20(23-25)22-18-5-3-4-6-19(18)27-2/h3-8,11-12,16H,9-10,13-14H2,1-2H3,(H,22,23) |
| InChIKey | HEGILUUIUFVKJL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|