C21H22FN3O3S — CID 9285671
3-[[cyclopropyl-[(4-fluorophenyl)methyl]amino]methyl]-5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazole-2-thione (PubChem CID 9285671) has the molecular formula C21H22FN3O3S and a molecular weight of 415.49 g/mol. Its IUPAC name is 3-[[cyclopropyl-[(4-fluorophenyl)methyl]amino]methyl]-5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[[cyclopropyl-[(4-fluorophenyl)methyl]amino]methyl]-5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 9285671 |
| Molecular Formula | C21H22FN3O3S |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 3-[[cyclopropyl-[(4-fluorophenyl)methyl]amino]methyl]-5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazole-2-thione |
| SMILES | COc1ccc(-c2nn(CN(Cc3ccc(F)cc3)C3CC3)c(=S)o2)cc1OC |
| InChI | InChI=1S/C21H22FN3O3S/c1-26-18-10-5-15(11-19(18)27-2)20-23-25(21(29)28-20)13-24(17-8-9-17)12-14-3-6-16(22)7-4-14/h3-7,10-11,17H,8-9,12-13H2,1-2H3 |
| InChIKey | PFSOKVBAPXYRPA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 52.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|