C18H19N3O4S — CID 56696877
5-(3,4-dimethoxyphenyl)-3-[(4-methoxyanilino)methyl]-1,3,4-oxadiazole-2-thione (PubChem CID 56696877) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-3-[(4-methoxyanilino)methyl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(3,4-dimethoxyphenyl)-3-[(4-methoxyanilino)methyl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 56696877 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-3-[(4-methoxyanilino)methyl]-1,3,4-oxadiazole-2-thione |
| SMILES | COc1ccc(NCn2nc(-c3ccc(OC)c(OC)c3)oc2=S)cc1 |
| InChI | InChI=1S/C18H19N3O4S/c1-22-14-7-5-13(6-8-14)19-11-21-18(26)25-17(20-21)12-4-9-15(23-2)16(10-12)24-3/h4-10,19H,11H2,1-3H3 |
| InChIKey | LCZIKEFOBJXNRJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 70.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|