C16H15N3O3S — CID 135585521
5-(2-hydroxyphenyl)-3-[(4-methoxyanilino)methyl]-1,3,4-oxadiazole-2-thione (PubChem CID 135585521) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is 5-(2-hydroxyphenyl)-3-[(4-methoxyanilino)methyl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(2-hydroxyphenyl)-3-[(4-methoxyanilino)methyl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 135585521 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 5-(2-hydroxyphenyl)-3-[(4-methoxyanilino)methyl]-1,3,4-oxadiazole-2-thione |
| SMILES | COc1ccc(NCn2nc(-c3ccccc3O)oc2=S)cc1 |
| InChI | InChI=1S/C16H15N3O3S/c1-21-12-8-6-11(7-9-12)17-10-19-16(23)22-15(18-19)13-4-2-3-5-14(13)20/h2-9,17,20H,10H2,1H3 |
| InChIKey | FWZXPBACALHGQH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|