C17H17N3O2S — CID 3570730
5-(2-methoxyphenyl)-3-[(4-methylanilino)methyl]-1,3,4-oxadiazole-2-thione (PubChem CID 3570730) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is 5-(2-methoxyphenyl)-3-[(4-methylanilino)methyl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(2-methoxyphenyl)-3-[(4-methylanilino)methyl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 3570730 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 5-(2-methoxyphenyl)-3-[(4-methylanilino)methyl]-1,3,4-oxadiazole-2-thione |
| SMILES | COc1ccccc1-c1nn(CNc2ccc(C)cc2)c(=S)o1 |
| InChI | InChI=1S/C17H17N3O2S/c1-12-7-9-13(10-8-12)18-11-20-17(23)22-16(19-20)14-5-3-4-6-15(14)21-2/h3-10,18H,11H2,1-2H3 |
| InChIKey | OYLOQVOELNBTGH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 52.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|