C28H36N6O4S2 — CID 5062301
3-[(2-methoxyanilino)methyl]-5-[8-[4-[(2-methoxyanilino)methyl]-5-sulfanylidene-1,3,4-oxadiazol-2-yl]octyl]-1,3,4-oxadiazole-2-thione (PubChem CID 5062301) has the molecular formula C28H36N6O4S2 and a molecular weight of 584.77 g/mol. Its IUPAC name is 3-[(2-methoxyanilino)methyl]-5-[8-[4-[(2-methoxyanilino)methyl]-5-sulfanylidene-1,3,4-oxadiazol-2-yl]octyl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[(2-methoxyanilino)methyl]-5-[8-[4-[(2-methoxyanilino)methyl]-5-sulfanylidene-1,3,4-oxadiazol-2-yl]octyl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 5062301 |
| Molecular Formula | C28H36N6O4S2 |
| Molecular Weight | 584.77 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | 3-[(2-methoxyanilino)methyl]-5-[8-[4-[(2-methoxyanilino)methyl]-5-sulfanylidene-1,3,4-oxadiazol-2-yl]octyl]-1,3,4-oxadiazole-2-thione |
| SMILES | COc1ccccc1NCn1nc(CCCCCCCCc2nn(CNc3ccccc3OC)c(=S)o2)oc1=S |
| InChI | InChI=1S/C28H36N6O4S2/c1-35-23-15-11-9-13-21(23)29-19-33-27(39)37-25(31-33)17-7-5-3-4-6-8-18-26-32-34(28(40)38-26)20-30-22-14-10-12-16-24(22)36-2/h9-16,29-30H,3-8,17-20H2,1-2H3 |
| InChIKey | GDRUHRVMABYAEU-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 104.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.77 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|