C19H18ClN3O4S — CID 126166583
N-(5-chloro-2-methoxyphenyl)-2-[5-[(2-methylphenoxy)methyl]-2-sulfanylidene-1,3,4-oxadiazol-3-yl]acetamide (PubChem CID 126166583) has the molecular formula C19H18ClN3O4S and a molecular weight of 419.89 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-[5-[(2-methylphenoxy)methyl]-2-sulfanylidene-1,3,4-oxadiazol-3-yl]acetamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-[5-[(2-methylphenoxy)methyl]-2-sulfanylidene-1,3,4-oxadiazol-3-yl]acetamide |
|---|---|
| PubChem CID | 126166583 |
| Molecular Formula | C19H18ClN3O4S |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-[5-[(2-methylphenoxy)methyl]-2-sulfanylidene-1,3,4-oxadiazol-3-yl]acetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)Cn1nc(COc2ccccc2C)oc1=S |
| InChI | InChI=1S/C19H18ClN3O4S/c1-12-5-3-4-6-15(12)26-11-18-22-23(19(28)27-18)10-17(24)21-14-9-13(20)7-8-16(14)25-2/h3-9H,10-11H2,1-2H3,(H,21,24) |
| InChIKey | TZYVYGHUZGGBKM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|